{{cart_num}}
My CartCAS：115532-50-8
Molecular Formula：C25H25ClN2O7
Molecular Weight：500.93
Storage：Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：Solid
Qty：
Size：
| CAS | 115532-50-8 |
| Name | TMRM Perchlorate |
| Molecular Formula | C25H25ClN2O7 |
| Molecular Weight | 500.93 |
| Solubility | Soluble in DMSO |
| Purity | ≥98% |
| Appearance | Solid |
| Storage | Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| MDL | MFCD00274460 |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=CC=CC=C4C(=O)OC.[O-]Cl(=O)(=O)=O |
| InChIKey | PFYWPQMAWCYNGW-UHFFFAOYSA-M |
| InChI | InChI=1S/C25H25N2O3.ClHO4/c1-26(2)16-10-12-20-22(14-16)30-23-15-17(27(3)4)11-13-21(23)24(20)18-8-6-7-9-19(18)25(28)29-5;2-1(3，4)5/h6-15H，1-5H3;(H，2，3，4，5)/q+1;/p-1 |
| PubChem CID | 11755725 |
| Background | It is a kind of cationic fluorescence probe with membrane permeability, which can specifically recognize the mitochondrial membrane potential, thus attaching to the mitochondria and producing bright fluorescence. At a certain concentration, rhodamine dyes have low toxicity to cells, so it is widely used to detect mitochondria in animal cells, plant cells and microorganisms. |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Manual Download
