{{cart_num}}
My CartCAS：89030-95-5
Molecular Formula：C14H21CuN6O4
Molecular Weight：400.9
Storage：Store at -20℃，1 year
Purity：≥98%
Appearance：Light blue to blue Solid
Qty：
Size：
| CAS | 89030-95-5 |
| Name | Copper tripeptide |
| Molecular Formula | C14H21CuN6O4 |
| Molecular Weight | 400.9 |
| Solubility | Soluble in --- |
| Purity | ≥98% |
| Appearance | Light blue to blue Solid |
| Storage | Store at -20℃，1 year |
| MDL | MFCD09842093 |
| SMILES | C1=C(NC=N1)CC(C(=O)NC(CCCCN)C(=O)[O-])NC(=O)CN.[Cu+2] |
| InChIKey | NZWIFMYRRCMYMN-ACMTZBLWSA-M |
| InChI | InChI=1S/C14H24N6O4.Cu/c15-4-2-1-3-10(14(23)24)20-13(22)11(19-12(21)6-16)5-9-7-17-8-18-9;/h7-8，10-11H，1-6，15-16H2，(H，17，18)(H，19，21)(H，20，22)(H，23，24);/q;+2/p-1/t10-，11-;/m0./s1 |
| PubChem CID | 71587328 |
| Target Point | Others |
| Passage | Others |
| Background | Copper tripeptide is a tripeptide. |
| Unit | Bottle |
| Specification | 100mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
