{{cart_num}}
My CartCAS：14320-04-8
Molecular Formula：C32H16N8Zn
Molecular Weight：577.9
Storage：Powder:2-8℃，2 years
Purity：≥95%
Appearance：Soild
Qty：
Size：
| CAS | 14320-04-8 |
| Name | Zinc phthalocyanine |
| Molecular Formula | C32H16N8Zn |
| Molecular Weight | 577.9 |
| Solubility | Soluble in --- |
| Purity | ≥95% |
| Appearance | Soild |
| Storage | Powder:2-8℃，2 years |
| EC | EINECS 238-262-5 |
| MDL | MFCD00041955 |
| SMILES | C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Zn+2] |
| InChIKey | PODBBOVVOGJETB-UHFFFAOYSA-N |
| InChI | InChI=1S/C32H16N8.Zn/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;/h1-16H;/q-2;+2 |
| PubChem CID | 114933 |
| Background | Zinc phthaline has common applications in industry (catalysts， photoconductors， etc. and biomedicine (photodynamic therapy， PDT). Zinc phthalocyanine can be used to photooxidize cyclohexane. |
| Unit | Bottle |
| Specification | 500mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
