{{cart_num}}
My CartCAS：61135-33-9
Molecular Formula：C11H12N2O5
Molecular Weight：252.22
Storage：Powder:-20℃,2years; Insolvent (mother liquid): -20°C, 6months; -80℃,1year
Purity：≥98%
Appearance：White to yellow Soild
Qty：
Size：
| CAS | 61135-33-9 |
| Name | 5-Ethynyl-2'-deoxyuridine |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.22 |
| Solubility | Soluble in DMSO ≥5mg/mL(Need ultrasonic) |
| Purity | ≥98% |
| Appearance | White to yellow Soild |
| Storage | Powder:-20℃,2years; Insolvent (mother liquid): -20°C, 6months; -80℃,1year |
| MDL | MFCD01675687 |
| SMILES | C#CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)O |
| InChIKey | CDEURGJCGCHYFH-DJLDLDEBSA-N |
| InChI | InChI=1S/C11H12N2O5/c1-2-6-4-13(11(17)12-10(6)16)9-3-7(15)8(5-14)18-9/h1，4，7-9，14-15H，3，5H2，(H，12，16，17)/t7-，8+，9+/m0/s1 |
| PubChem CID | 472172 |
| Target Point | Others |
| Passage | Others |
| Background | 5-Ethynyl-2-deoxyuridine(EdU) is a thymidine nucleoside analogues capable of insertion into DNA molecules being replicated during cell proliferation, and the subsequent [3 + 2] cycloaddition reaction of EdU with fluorescent azide catalyzed by copper can be developed as a method for detecting DNA synthesis. It is also an alkyl chain based PROTAC linker that can be used in PROTAC synthesis. |
| Unit | Bottle |
| Specification | 50mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
