{{cart_num}}
My CartCAS：1393363-07-9
Molecular Formula：C34H40ClN3O4
Molecular Weight：590.15
Storage：Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：Soild
Qty：
Size：
| CAS | 1393363-07-9 |
| Name | Cy3 NHS ester |
| Molecular Formula | C34H40ClN3O4 |
| Molecular Weight | 590.15 |
| Solubility | Soluble in DMSO ≥10mg/mL(Need ultrasonic) |
| Purity | ≥98% |
| Appearance | Soild |
| Storage | Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| SMILES | CC1(C2=CC=CC=C2[N+](=C1/C=C/C=C3/C(C4=CC=CC=C4N3CCCCCC(=O)ON5C(=O)CCC5=O)(C)C)C)C.[Cl-] |
| InChIKey | KWDMHANYPGHTLW-UHFFFAOYSA-M |
| InChI | InChI=1S/C34H40N3O4.ClH/c1-33(2)24-14-8-10-16-26(24)35(5)28(33)18-13-19-29-34(3，4)25-15-9-11-17-27(25)36(29)23-12-6-7-20-32(40)41-37-30(38)21-22-31(37)39;/h8-11，13-19H，6-7，12，20-23H2，1-5H3;1H/q+1;/p-1 |
| PubChem CID | 155487015 |
| Background | Cy3 NHS ester is a Cy3 containing the N-Hydroxysuccinimide activating group， which can react directly with the amino group (-NH2) on biochemical molecules to form stable amide bonds， mainly primary amines. Ex/Em(nm)=550/570. |
| Unit | Bottle |
| Specification | 1mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Manual Download
