{{cart_num}}
My CartCAS：2408482-09-5
Molecular Formula：C41H48N3BF4O4
Molecular Weight：733.66
Storage：Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥95%
Appearance：Soild
Qty：
Size：
| CAS | 2408482-09-5 |
| Name | Cyanine7 NHS ester |
| Molecular Formula | C41H48N3BF4O4 |
| Molecular Weight | 733.66 |
| Solubility | Soluble in DMSO |
| Purity | ≥95% |
| Appearance | Soild |
| Storage | Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| SMILES | [B-](F)(F)(F)F.CC1(C2=CC=CC=C2[N+](=C1C=CC3=CC(=CC=C4C(C5=CC=CC=C5N4CCCCCC(=O)ON6C(=O)CCC6=O)(C)C)CCC3)C)C |
| InChIKey | MNKUQMKZCXWMOK-UHFFFAOYSA-N |
| InChI | InChI=1S/C41H48N3O4.BF4/c1-40(2)31-16-8-10-18-33(31)42(5)35(40)23-21-29-14-13-15-30(28-29)22-24-36-41(3，4)32-17-9-11-19-34(32)43(36)27-12-6-7-20-39(47)48-44-37(45)25-26-38(44)46;2-1(3，4)5/h8-11，16-19，21-24，28H，6-7，12-15，20，25-27H2，1-5H3;/q+1;-1 |
| PubChem CID | 145714649 |
| Background | Cy7 NHS ester is a Cy7 containing N-Hydroxysuccinimide (N-hydroxysuccinimide) activating group， which can directly react with amino group (-NH2) on biochemical molecules to form stable amide bonds， mainly primary amine， also can label polymer amine group， nano surface amine group， etc. Ex/Em(nm)=740/770. |
| Unit | Bottle |
| Specification | 1mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
