{{cart_num}}
My CartCAS：145037-81-6
Molecular Formula：C52H59BrN4O19
Molecular Weight：1123.94
Storage：Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥95%
Appearance：Solid
Qty：
Size：
| CAS | 145037-81-6 |
| Name | Rhod-2 AM |
| Molecular Formula | C52H59BrN4O19 |
| Molecular Weight | 1123.94 |
| Solubility | Soluble in DMSO |
| Purity | ≥95% |
| Appearance | Solid |
| Storage | Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| MDL | MFCD00082575 |
| SMILES | CC1=CC(=C(C=C1)N(CC(=O)OCOC(=O)C)CC(=O)OCOC(=O)C)OCCOC2=C(C=CC(=C2)C3=C4C=CC(=[N+](C)C)C=C4OC5=C3C=CC(=C5)N(C)C)N(CC(=O)OCOC(=O)C)CC(=O)OCOC(=O)C.[Br-] |
| InChIKey | RWXWZOWDWYQKBK-UHFFFAOYSA-M |
| InChI | InChI=1S/C52H59N4O19.BrH/c1-32-10-16-42(55(24-48(61)71-28-67-33(2)57)25-49(62)72-29-68-34(3)58)46(20-32)65-18-19-66-47-21-37(11-17-43(47)56(26-50(63)73-30-69-35(4)59)27-51(64)74-31-70-36(5)60)52-40-14-12-38(53(6)7)22-44(40)75-45-23-39(54(8)9)13-15-41(45)52;/h10-17，20-23H，18-19，24-31H2，1-9H3;1H/q+1;/p-1 |
| PubChem CID | 25229581 |
| Background | Rhod-2 AM is an acetyl methyl ester derivative of Rhod-2， which has cell membrane permeability and can be used for calcium flux measurement.Ex/Em=549/578 nm. |
| Unit | Bottle |
| Specification | 50ug 1mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
