{{cart_num}}
My CartCAS：756526-06-4
Molecular Formula：C23H47NO10
Molecular Weight：497.62
Storage：Store at 2-8℃，2 years
Purity：≥95%
Appearance：Liquid
Qty：
Size：
| CAS | 756526-06-4 |
| Name | Amino-PEG8-Boc |
| Molecular Formula | C23H47NO10 |
| Molecular Weight | 497.62 |
| Solubility | Soluble in Water/DMSO |
| Purity | ≥95% |
| Appearance | Liquid |
| Storage | Store at 2-8℃，2 years |
| MDL | MFCD11041142 |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN |
| InChIKey | UMJVFHNJPJVDSB-UHFFFAOYSA-N |
| InChI | InChI=1S/C23H47NO10/c1-23(2，3)34-22(25)4-6-26-8-10-28-12-14-30-16-18-32-20-21-33-19-17-31-15-13-29-11-9-27-7-5-24/h4-21，24H2，1-3H3 |
| PubChem CID | 53433575 |
| Target Point | Others |
| Passage | Others |
| Background | Amino-PEG8-Boc is a cleavable 8-unit PEG-ADC connector that can be used in the synthesis of antibody-coupled active molecules (ADCs). Amino-PEG8-Boc is also a PEG-based PROTAC linker that can be used in the synthesis of PROTAC. |
| Unit | Bottle |
| Specification | 100mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
