{{cart_num}}
My CartCAS：736992-21-5(Free base)
Molecular Formula：C34H53N9O7
Molecular Weight：699.84
Storage：Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：White to off-white Solid
Qty：
Size：
| CAS | 736992-21-5(Free base) |
| Name | Elamipretide Triacetate |
| Molecular Formula | C34H53N9O7 |
| Molecular Weight | 699.84 |
| Solubility | Soluble in --- |
| Purity | ≥98% |
| Appearance | White to off-white Solid |
| Storage | Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| SMILES | CC1=CC(=CC(=C1CC(C(=O)NC(CCCCN)C(=O)NC(CC2=CC=CC=C2)C(=O)N)NC(=O)C(CCCN=C(N)N)N)C)O |
| InChIKey | SFVLTCAESLKEHH-WKAQUBQDSA-N |
| InChI | InChI=1S/C32H49N9O5/c1-19-15-22(42)16-20(2)23(19)18-27(41-29(44)24(34)11-8-14-38-32(36)37)31(46)39-25(12-6-7-13-33)30(45)40-26(28(35)43)17-21-9-4-3-5-10-21/h3-5，9-10，15-16，24-27，42H，6-8，11-14，17-18，33-34H2，1-2H3，(H2，35，43)(H，39，46)(H，40，45)(H，41，44)(H4，36，37，38)/t24-，25+，26+，27+/m1/s1 |
| PubChem CID | 11764719 |
| Target Point | Mitochondrial Metabolism |
| Passage | Metabolic Enzyme&Protease |
| Background | Elamipretide acetate, a derivative of Elamipretide, is a small mitochondria-targeting tetrapeptide (D-Arg-dimethylTyr-Lys-Phe-NH2) that can be used in studies to reduce the production of toxic reactive oxygen species and stabilize cardiolipin. |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
