{{cart_num}}
My CartCAS：875770-34-6
Molecular Formula：C18H32N6O5S
Molecular Weight：444.55
Storage：Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥95%
Appearance：Solid
Qty：
Size：
| CAS | 875770-34-6 |
| Name | Biotin-PEG3-azide |
| Molecular Formula | C18H32N6O5S |
| Molecular Weight | 444.55 |
| Solubility | Soluble in DMSO ≥10mg/mL |
| Purity | ≥95% |
| Appearance | Solid |
| Storage | Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| MDL | MFCD20134145 |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCN=[N+]=[N-])NC(=O)N2 |
| InChIKey | ZWFOOMQCYIGZBE-ZOBUZTSGSA-N |
| InChI | InChI=1S/C18H32N6O5S/c19-24-21-6-8-28-10-12-29-11-9-27-7-5-20-16(25)4-2-1-3-15-17-14(13-30-15)22-18(26)23-17/h14-15，17H，1-13H2，(H，20，25)(H2，22，23，26)/t14-，15-，17-/m0/s1 |
| PubChem CID | 60146223 |
| Target Point | Others |
| Passage | PROTAC |
| Background | Biotin-PEG3-azide is a PEG-structured PROTAC linker that can be used for the synthesis of PROTAC. Biotin-PEG3-azide is a click chemical. It contains Azide groups and can undergo copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) with molecules containing Alkyne groups. Strain-promoted acetylene-azide cycloaddition reactions (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
