{{cart_num}}
My CartCAS：55297-96-6
Molecular Formula：C32H51NO8S
Molecular Weight：609.81
Storage：Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：White to off-white Solid
Qty：
Size：
| CAS | 55297-96-6 |
| Name | Tiamulin Fumarate |
| Molecular Formula | C32H51NO8S |
| Molecular Weight | 609.81 |
| Solubility | Soluble in DMSO/Water/Ethanol ≥10mg/mL(Need ultrasonic) |
| Purity | ≥98% |
| Appearance | White to off-white Solid |
| Storage | Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| EC | EINECS 259-581-6 |
| MDL | MFCD27966802 |
| SMILES | CCN(CC)CCSCC(=O)OC1CC(C(C(C23CCC(C1(C2C(=O)CC3)C)C)C)O)(C)C=C.C(=CC(=O)O)C(=O)O |
| InChIKey | YXQXDXAHCSEVSD-GCYNEOGWSA-N |
| InChI | InChI=1S/C28H47NO4S.C4H4O4/c1-8-26(6)17-22(33-23(31)18-34-16-15-29(9-2)10-3)27(7)19(4)11-13-28(20(5)25(26)32)14-12-21(30)24(27)28;5-3(6)1-2-4(7)8/h8，19-20，22，24-25，32H，1，9-18H2，2-7H3;1-2H，(H，5，6)(H，7，8)/b;2-1+/t19-，20+，22-，24+，25+，26-，27+，28+;/m1./s1 |
| PubChem CID | 23725049 |
| Target Point | Antibiotic |
| Passage | Anti-infection |
| Background | Tiamulin Fumarate is a diterpenoid antibiotic with antibacterial activity and inhibition of protein synthesis， which can be used to study balloon inflammation caused by mycoplasma infection. |
| Unit | Bottle |
| Specification | 25mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
