| CAS |
71963-77-4 |
| Chinese Name |
蒿甲醚 |
| English Name |
Artemether |
| Synonyms |
Dihydroartemisinin methyl ether;SM224;Dihydroqinghaosu methyl ether;CGP 56696 |
| Molecular Formula |
C16H26O5 |
| Molecular Weight |
298.37 |
| Solubility |
Soluble in DMSO |
| Purity |
HPLC≥98% |
| Appearance |
White to off-white Solid |
| Storage |
Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| EC |
EINECS 663-549-0 |
| MDL |
MFCD00866205 |
| SMILES |
C[C@H]1[C@@H](OC)O[C@@]2([H])[C@]34[C@@]([C@H](C)CC[C@]41[H])([H])CC[C@@](O2)(C)OO3 |
| InChIKey |
SXYIRMFQILZOAM-HVNFFKDJSA-N |
| InChI |
InChI=1S/C16H26O5/c1-9-5-6-12-10(2)13(17-4)18-14-16(12)11(9)7-8-15(3,19-14)20-21-16/h9-14H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14-,15-,16-/m1/s1 |
| PubChem CID |
68911 |
| Target Point |
Parasite |
| Passage |
Anti-infection |
| Background |
Artemether is a compound with antimalarial activity |
| Biological Activity |
Artemether, a derivative of the antimalarial drug artemisinin. [1] |
| In Vitro |
Artemether exhibits the highest activity against juvenile stages of the parasites，while adult worms are significantly less susceptible. There was no indication of neurotoxicity following repeated high doses of artemether given fortnightly for up to 5 months. [1] |
| In Vivo |
There were remarkably inhibitory effects of artmeter on brain glioma growth and angiogenesis in SD rats and the mechanism that artemether inhibited brain glioma growth might be penetrating the blood-brain barrier and inhibiting angiogenesis.[2] |
| Animal Experiment |
Forty SD rats which were subcutaneous planted with SD rat C6 glioma cell to establish SD rat orthotopic glioma model were divided resourcefully into 5 groups. each group was 8 rats. Length-path(a mm)and short-path(b mm)of tumor each rat was measured. Tumor volume was calculated using the following formula: V(mm(3))= a(2)bpi/6. Microvessel density(MVD)in different therapy groups was significantly lower than that in normal saline control group and brain glioma volume in different therapy groups was significantly smaller than that in normal saline control group.[2] |
| Data Literature Source |
[1]. Xiao，S.，et al.，Recent investigations of artemether，a novel agent for the prevention of schistosomiasis japonica，mansoni and haematobia. Acta Trop，2002. 82(2): p. 175-81.
[2]. Wu，Z.P.，et al.，Inhibitive effect of artemether on tumor growth and angiogenesis in the rat C6 orthotopic brain gliomas model. Integr Cancer Ther，2009. 8(1): p. 88-92. |
| Unit |
Bottle |
| Specification |
10mg 10mM*1mL in DMSO 50mg 100mg |
English
中文
Manual Download
