{{cart_num}}
My CartCAS：482-89-3
Molecular Formula：C16H10N2O2
Molecular Weight：262.26
Storage：Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：HPLC≥98%
Appearance：Blue-black Solid
Qty：
Size：
| CAS | 482-89-3 |
| Name | Indigo |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.26 |
| Solubility | Soluble in DMSO ≥5mg/mL |
| Purity | HPLC≥98% |
| Appearance | Blue-black Solid |
| Storage | Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| EC | EINECS 207-586-9 |
| MDL | MFCD00005722 |
| SMILES | O=C1/C(NC2=C1C=CC=C2)=C3NC4=C(C=CC=C4)C/3=O |
| InChIKey | QQILFGKZUJYXGS-UHFFFAOYSA-N |
| InChI | InChI=1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17,19H |
| PubChem CID | 10215 |
| Background | Indigo is a dark indole group dye. |
| Unit | Bottle |
| Specification | 20mg 10mM*1mL in DMSO 50mg 100mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
