{{cart_num}}
My CartCAS：29342-05-0
Molecular Formula：C12H17NO2
Molecular Weight：207.27
Storage：Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：White to light yellow Solid
Qty：
Size：
| CAS | 29342-05-0 |
| Name | Ciclopirox |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 |
| Solubility | Soluble in DMSO |
| Purity | ≥98% |
| Appearance | White to light yellow Solid |
| Storage | Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| EC | EINECS 249-577-2 |
| MDL | MFCD00599441 |
| SMILES | CC(C=C(C1CCCCC1)N2O)=CC2=O |
| InChIKey | SCKYRAXSEDYPSA-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H17NO2/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10/h7-8,10,15H,2-6H2,1H3 |
| PubChem CID | 2749 |
| Target Point | Fungal |
| Passage | Anti-infection |
| Background | Ciclopirox is an antifungal compound. |
| Data Literature Source | [1]. Niewerth，M.，et al.，Ciclopirox olamine treatment affects the expression pattern of Candida albicans genes encoding virulence factors，iron metabolism proteins，and drug resistance factors. Antimicrob Agents Chemother，2003. 47(6): p. 1805-17. [2]. Leem，S.H.，et al.，The possible mechanism of action of ciclopirox olamine in the yeast Saccharomyces cerevisiae. Mol Cells，2003. 15(1): p. 55-61. |
| Unit | Bottle |
| Specification | 25mg 50mg 100mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
